Bài tập phân tích

1-Hòa tan 1,25gam axit HA trong 50,00ml nước. Cần phải dùng 41,20ml NaOH M để chuẩn độ hết lượng axit này. Biết rằng sau khi thêm 8,24ml dd NaOH nói trên thì pH của dung dịch thu được là 4,30. a) Tính khối lượng phân tử M và hằng số phân ly của axit HA(cái này em…bí). b) Tính pH tương đương của phép chuẩn độ. 2-Người ta tiến hành chuẩn độ 20,00ml dung dịch Fe3+ 0.05M bằng dung dịch TiCl3 0.02m với pH=0 không đổi, phản ứng chuẩn độ xảy ra như sau: Fe3+ + Ti3+ + H2O = Fe2+ + TiO2+ + 2H+ a) Tính hằng số cân bằng của phản ứng chuẩn độ. b) Tính nồng độ Fe3+ tại điểm tương đương. c) Tính thể tích của dung dịch TiCl3 đã dùng nếu chuẩn độ đến thế điện cực Pt trong dung dịch là 0.33 volt Cho E0(Fe3+/Fe2+)=0.77volt E0(TiO2+/Ti3+)=0.1volt

nồng độ NaOH bao nhiu vậy em?

to Tuan1989: bài này mình có 3 ẩn: x-nồng độ ban đầu HA, y-nồng độ NaOH và k-hằng số phân ly HA. Đề bài cho khá nhiều dữ liệu, đủ để lập các hệ pt. về hằng số phân ly thì: k=[H+][A-] / [HA] (1), trong đó [A-]=[H+], còn [HA]=x-[H+], với x là nồng độ ban đầu của HA. Như vậy, hoàn toàn có thể đưa phương trình (1) về dạng pt k=f([H+]). Tại điểm tương đương, thêm 1 phương trình nữa. Tại điểm thêm 8.24ml NaOH, xảy ra phản ứng: H+ + OH- = H2O, một lượng H+ giảm, một lương HA sẽ bị phân ly để cho thêm H+ nhằm đảm bảo hệ số k là không đổi, mình lập thêm 1 hệ phương trình nữa ở đây. Em cần xem kỹ lại lý thuyết về phần hằng số phân ly thì mới có thể lập phương trình được, ở đây anh không lập sẵn phương trình, vì muốn em học lý thuyết để biết cái gọi là

phần này cũng bình thường thôi !em cứ phân tích đề bài thật tốt là có ngay thôi mà !chước tiên ta theo định luật đương lượng ta tính được M khi ta dùng 8,24ml NaOH M thì dd có PH=4,3Tuwf đó ta tính được nồng độ [H+] rồi theo PT phân ly ta tính được nồng độ [a-] thế là bài toán đà được giải quyết rồi! mà bạn cho mình hỏi bạn học trường nào vậy?

bạn nào chỉ như giải bài với :24h_041:Hãy tính nồng độ đương lượng và độ chuẩn của dd H2SO4, nếu khi chuản độ 50ml dd thu được khi hòa tan 0.5g Na2CO3 trong bình định mức 200ml thì hết 24ml dd H2SO4. xin chân thành cảm ơn trước nhé!

có nồng độ đương lượng Na2CO3 = 0,5/(530,2) =0.047 N N1V1 = N2V2 N(H2SO4) = 500.047 / 24 = 0.098 N 0.098N <=> 0.098/2 M = 0.049M độ chuẩn T= 0.049*98 = 4.8 g/lit

ai pro về hóa phân tích giải hộ với, có tài liệu nào hay cho luôn nha hihi. cảm ơn nhiều^1000… nha :noel6 ( tính ph cua dung dich gồm a) H2SO4 0.02 M và HF 0.001M biết pKa của HF lả 3.17 và HSO4- là 2 b) H2C2O4 0.1M và NaOH 0.095M

bạn đó giải đúng rồi đó

Cái này đơn giản mà! H2SO4 phân li hoàn toàn ra HSO4- Cái này ko thể bỏ qua cân bằng phân li ra proton nào nên phải tính hết thep phương trình proton:(H)=(SO4)+(F)+(H1) .Kết hợp với bảo toàn nồng độ ban đầu của HSO4 và HF thế vô giải ra thui:pH=1.6(h1) là H+ do H2SO4 phân li ra là 0.02M:hutthuoc( b/CHuyển về hệ đệm rùi giải.Ko cho Ka sao giải bạn!

giải kỉ hơn tí đi, ít tài liệu nói về vấn đề này quá nên không hiểu lắm. giải đầy đủ cho mình xem với. pKa của HSO4- là 2. của HF =3.17

cái này mình củng không hiểu ai biết giải rỏ luôn đi, giúp thì giúp cho trót đi mà

a. acid sulfuric là acid mạnh, nấc 1 phân ly hoàn toàn, nấc 2 có pK = 2, có thể xem dung dịch này chứa 2 đơn acid: 1 acid mạnh + 1 acid yếu đều có nồng độ 0.02M. HF là acid yếu hơn HSO4(-) và có nồng độ nhỏ hơn nhiều nên có thể bỏ qua được so với 2 acid kia. Như vậy xem dung dịch hỗn hợp H2SO4 0.02M và HF 0.001 M chỉ có H2SO4 0.02M. H2SO4 --> (H+)1 + HSO4(-) HSO4(-) <–> (H+)2 + SO4(2-) K = (H+)(SO4)/(HSO4) = (H+)1+(H+)22/[(0.02-(H+)2] –> 0.01 = (0.02+(H+)22/[(0.02-(H+)2] –> [(H+)2]^2 + 0.03[(H+)2]-0.0002=0 –> [(H+)2] = 0.005615 Nồng độ H(+) trong dung dịch (H+) = (H+)1 + (H+)2 = 0.02 + 0.005615 = 0.025615 M –> pH = 1.59 b. Phản ứng acid baz: H2C2O4 + NaOH = NaHC2O4 + H2O 0.095 0.095 Vậy sau phản ứng dung dịch dư 0.005 M H2C2O4 và 0.095M NaHC2O4 --> tính gần đúng [H] = Ka{Ca-[H]+[OH]}/{Cb+[H]-[OH]}=10^-1.27{0.005-[H]+[OH]}/{0.095+[H]-[OH]}. Dung dịch có tính acid nên bỏ [OH]cạnh [H] –> [H] =10^-1.27{0.005-[H]}/{0.095+[H]} –> [H]^2 + 0.1487[H]-0.0002685 =0 –> pH = 2.75 (có thể giải gần đúng theo như dung dịch đệm thông thường bằng cách bỏ luôn [H] cạnh Ca, Cb trong phương trình trên –> pH = 1.27 + lg{0.095/0.005} = 2.55. Cách giải này tuy nhiên kém chính xác). Thân ái

ban tìm tài liệu giáo khoa chuyên hóa tâp 1 mà đọc ở đó có tuốt :art (

Bài đăng lắm rôi bạn ơi …